About 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid
4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 56873635) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 56873635 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | CC1CNC(=O)CCN1Cc1cn[nH]c1C(=O)O |
| InChI | InChI=1S/C11H16N4O3/c1-7-4-12-9(16)2-3-15(7)6-8-5-13-14-10(8)11(17)18/h5,7H,2-4,6H2,1H3,(H,12,16)(H,13,14)(H,17,18) |
| InChIKey | WTKPIGADJLGYJX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid (CID 56873635) is 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid is CC1CNC(=O)CCN1Cc1cn[nH]c1C(=O)O.
What is the InChIKey of 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid?
The InChIKey is WTKPIGADJLGYJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c1-7-4-12-9(16)2-3-15(7)6-8-5-13-14-10(8)11(17)18/h5,7H,2-4,6H2,1H3,(H,12,16)(H,13,14)(H,17,18).
What are the key properties of 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid?
4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid has a molecular weight of 252.27 g/mol, XLogP of -0.18, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 56873635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).