C15H24N2O2 — CID 95196070
(2R)-2-cyano-N-methyl-3-oxo-4-[(1R,5S)-3,3,5-trimethylcyclohexyl]butanamide (PubChem CID 95196070) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R)-2-cyano-N-methyl-3-oxo-4-[(1R,5S)-3,3,5-trimethylcyclohexyl]butanamide.
| Compound Name | (2R)-2-cyano-N-methyl-3-oxo-4-[(1R,5S)-3,3,5-trimethylcyclohexyl]butanamide |
|---|---|
| PubChem CID | 95196070 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (2R)-2-cyano-N-methyl-3-oxo-4-[(1R,5S)-3,3,5-trimethylcyclohexyl]butanamide |
| SMILES | CNC(=O)[C@H](C#N)C(=O)C[C@@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-10-5-11(8-15(2,3)7-10)6-13(18)12(9-16)14(19)17-4/h10-12H,5-8H2,1-4H3,(H,17,19)/t10-,11-,12+/m0/s1 |
| InChIKey | MUZOKSPRXKEVSL-SDDRHHMPSA-N |
| XLogP | 2.29 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|