C18H23N3O2 — CID 95196207
(2S)-N,N-diethyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 95196207) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S)-N,N-diethyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N,N-diethyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95196207 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2S)-N,N-diethyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN1C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H23N3O2/c1-3-20(4-2)18(23)16-10-7-11-21(16)17(22)15-12-13-8-5-6-9-14(13)19-15/h5-6,8-9,12,16,19H,3-4,7,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | BRPNKHGDHPJKCD-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |