C20H32N2O2S — CID 95198454
(3S)-1-(cyclohexylmethyl)-3-hydroxy-3-[[2-(3-methylthiophen-2-yl)ethylamino]methyl]piperidin-2-one (PubChem CID 95198454) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is (3S)-1-(cyclohexylmethyl)-3-hydroxy-3-[[2-(3-methylthiophen-2-yl)ethylamino]methyl]piperidin-2-one.
| Compound Name | (3S)-1-(cyclohexylmethyl)-3-hydroxy-3-[[2-(3-methylthiophen-2-yl)ethylamino]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95198454 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3S)-1-(cyclohexylmethyl)-3-hydroxy-3-[[2-(3-methylthiophen-2-yl)ethylamino]methyl]piperidin-2-one |
| SMILES | Cc1ccsc1CCNC[C@@]1(O)CCCN(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C20H32N2O2S/c1-16-9-13-25-18(16)8-11-21-15-20(24)10-5-12-22(19(20)23)14-17-6-3-2-4-7-17/h9,13,17,21,24H,2-8,10-12,14-15H2,1H3/t20-/m0/s1 |
| InChIKey | ISLZRCRRYMAJRZ-FQEVSTJZSA-N |
| XLogP | 3.12 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|