C17H30N2O2 — CID 45201622
3-[(cyclobutylamino)methyl]-1-(cyclohexylmethyl)-3-hydroxypiperidin-2-one (PubChem CID 45201622) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-[(cyclobutylamino)methyl]-1-(cyclohexylmethyl)-3-hydroxypiperidin-2-one.
| Compound Name | 3-[(cyclobutylamino)methyl]-1-(cyclohexylmethyl)-3-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 45201622 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-[(cyclobutylamino)methyl]-1-(cyclohexylmethyl)-3-hydroxypiperidin-2-one |
| SMILES | O=C1N(CC2CCCCC2)CCCC1(O)CNC1CCC1 |
| InChI | InChI=1S/C17H30N2O2/c20-16-17(21,13-18-15-8-4-9-15)10-5-11-19(16)12-14-6-2-1-3-7-14/h14-15,18,21H,1-13H2 |
| InChIKey | LVWWGKVDULEMMF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |