C17H32N2O3 — CID 26391310
(3R)-3-[(cyclooctylamino)methyl]-3-hydroxy-1-(2-methoxyethyl)piperidin-2-one (PubChem CID 26391310) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is (3R)-3-[(cyclooctylamino)methyl]-3-hydroxy-1-(2-methoxyethyl)piperidin-2-one.
| Compound Name | (3R)-3-[(cyclooctylamino)methyl]-3-hydroxy-1-(2-methoxyethyl)piperidin-2-one |
|---|---|
| PubChem CID | 26391310 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | (3R)-3-[(cyclooctylamino)methyl]-3-hydroxy-1-(2-methoxyethyl)piperidin-2-one |
| SMILES | COCCN1CCC[C@@](O)(CNC2CCCCCCC2)C1=O |
| InChI | InChI=1S/C17H32N2O3/c1-22-13-12-19-11-7-10-17(21,16(19)20)14-18-15-8-5-3-2-4-6-9-15/h15,18,21H,2-14H2,1H3/t17-/m1/s1 |
| InChIKey | FNDMFQWQDVWLKE-QGZVFWFLSA-N |
| XLogP | 1.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |