C20H29FN2O3 — CID 45236045
3-[(cyclohexylamino)methyl]-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one (PubChem CID 45236045) has the molecular formula C20H29FN2O3 and a molecular weight of 364.46 g/mol. Its IUPAC name is 3-[(cyclohexylamino)methyl]-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one.
| Compound Name | 3-[(cyclohexylamino)methyl]-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 45236045 |
| Molecular Formula | C20H29FN2O3 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[(cyclohexylamino)methyl]-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one |
| SMILES | COc1ccc(F)c(CN2CCCC(O)(CNC3CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C20H29FN2O3/c1-26-17-8-9-18(21)15(12-17)13-23-11-5-10-20(25,19(23)24)14-22-16-6-3-2-4-7-16/h8-9,12,16,22,25H,2-7,10-11,13-14H2,1H3 |
| InChIKey | WHXNNFKEXBADFX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |