C17H24FN3O4 — CID 95200120
3-[[(3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]propanamide (PubChem CID 95200120) has the molecular formula C17H24FN3O4 and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-[[(3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]propanamide.
| Compound Name | 3-[[(3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 95200120 |
| Molecular Formula | C17H24FN3O4 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-[[(3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-2-oxopiperidin-3-yl]methylamino]propanamide |
| SMILES | COc1ccc(F)c(CN2CCC[C@](O)(CNCCC(N)=O)C2=O)c1 |
| InChI | InChI=1S/C17H24FN3O4/c1-25-13-3-4-14(18)12(9-13)10-21-8-2-6-17(24,16(21)23)11-20-7-5-15(19)22/h3-4,9,20,24H,2,5-8,10-11H2,1H3,(H2,19,22)/t17-/m0/s1 |
| InChIKey | UGOFTSJIFKNFFG-KRWDZBQOSA-N |
| XLogP | 0.15 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|