C18H27FN2O3 — CID 95198141
(3R)-3-(butylaminomethyl)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one (PubChem CID 95198141) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is (3R)-3-(butylaminomethyl)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one.
| Compound Name | (3R)-3-(butylaminomethyl)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 95198141 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3R)-3-(butylaminomethyl)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxypiperidin-2-one |
| SMILES | CCCCNC[C@]1(O)CCCN(Cc2cc(OC)ccc2F)C1=O |
| InChI | InChI=1S/C18H27FN2O3/c1-3-4-9-20-13-18(23)8-5-10-21(17(18)22)12-14-11-15(24-2)6-7-16(14)19/h6-7,11,20,23H,3-5,8-10,12-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | GYGJPMQCNYABET-GOSISDBHSA-N |
| XLogP | 2.08 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|