C22H27FN2O3 — CID 95553831
(3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-phenylethylamino)methyl]piperidin-2-one (PubChem CID 95553831) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is (3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-phenylethylamino)methyl]piperidin-2-one.
| Compound Name | (3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-phenylethylamino)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95553831 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-phenylethylamino)methyl]piperidin-2-one |
| SMILES | COc1ccc(F)c(CN2CCC[C@](O)(CNCCc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C22H27FN2O3/c1-28-19-8-9-20(23)18(14-19)15-25-13-5-11-22(27,21(25)26)16-24-12-10-17-6-3-2-4-7-17/h2-4,6-9,14,24,27H,5,10-13,15-16H2,1H3/t22-/m0/s1 |
| InChIKey | QXJBMQPNVVKKPV-QFIPXVFZSA-N |
| XLogP | 2.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|