C21H32FN3O3 — CID 56708991
1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-piperidin-1-ylethylamino)methyl]piperidin-2-one (PubChem CID 56708991) has the molecular formula C21H32FN3O3 and a molecular weight of 393.50 g/mol. Its IUPAC name is 1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-piperidin-1-ylethylamino)methyl]piperidin-2-one.
| Compound Name | 1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-piperidin-1-ylethylamino)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 56708991 |
| Molecular Formula | C21H32FN3O3 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-piperidin-1-ylethylamino)methyl]piperidin-2-one |
| SMILES | COc1ccc(F)c(CN2CCCC(O)(CNCCN3CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C21H32FN3O3/c1-28-18-6-7-19(22)17(14-18)15-25-12-5-8-21(27,20(25)26)16-23-9-13-24-10-3-2-4-11-24/h6-7,14,23,27H,2-5,8-13,15-16H2,1H3 |
| InChIKey | YMPGSMPWXRUPLT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|