C21H26FN3O3 — CID 95220202
(3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-pyridin-3-ylethylamino)methyl]piperidin-2-one (PubChem CID 95220202) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is (3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-pyridin-3-ylethylamino)methyl]piperidin-2-one.
| Compound Name | (3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-pyridin-3-ylethylamino)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95220202 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (3S)-1-[(2-fluoro-5-methoxyphenyl)methyl]-3-hydroxy-3-[(2-pyridin-3-ylethylamino)methyl]piperidin-2-one |
| SMILES | COc1ccc(F)c(CN2CCC[C@](O)(CNCCc3cccnc3)C2=O)c1 |
| InChI | InChI=1S/C21H26FN3O3/c1-28-18-5-6-19(22)17(12-18)14-25-11-3-8-21(27,20(25)26)15-24-10-7-16-4-2-9-23-13-16/h2,4-6,9,12-13,24,27H,3,7-8,10-11,14-15H2,1H3/t21-/m0/s1 |
| InChIKey | FYLLTGLWAZTYQT-NRFANRHFSA-N |
| XLogP | 1.92 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|