C15H20N2O4 — CID 95200054
(2R)-N-[3-(3-methylanilino)-3-oxopropyl]-1,4-dioxane-2-carboxamide (PubChem CID 95200054) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2R)-N-[3-(3-methylanilino)-3-oxopropyl]-1,4-dioxane-2-carboxamide.
| Compound Name | (2R)-N-[3-(3-methylanilino)-3-oxopropyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 95200054 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2R)-N-[3-(3-methylanilino)-3-oxopropyl]-1,4-dioxane-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)CCNC(=O)[C@H]2COCCO2)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-11-3-2-4-12(9-11)17-14(18)5-6-16-15(19)13-10-20-7-8-21-13/h2-4,9,13H,5-8,10H2,1H3,(H,16,19)(H,17,18)/t13-/m1/s1 |
| InChIKey | NGVABHLOJWVICA-CYBMUJFWSA-N |
| XLogP | 0.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |