C18H25N5O — CID 95200575
(9aR)-2-(7-methoxy-4-methylquinazolin-2-yl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 95200575) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (9aR)-2-(7-methoxy-4-methylquinazolin-2-yl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | (9aR)-2-(7-methoxy-4-methylquinazolin-2-yl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 95200575 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (9aR)-2-(7-methoxy-4-methylquinazolin-2-yl)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | COc1ccc2c(C)nc(N3CCN4CCN(C)C[C@@H]4C3)nc2c1 |
| InChI | InChI=1S/C18H25N5O/c1-13-16-5-4-15(24-3)10-17(16)20-18(19-13)23-9-8-22-7-6-21(2)11-14(22)12-23/h4-5,10,14H,6-9,11-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | ZQMFTDNBOOXZGI-CQSZACIVSA-N |
| XLogP | 1.38 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |