C21H26N4OS — CID 126464393
1-(7-methoxy-4-methylquinazolin-2-yl)-N-(2-thiophen-2-ylethyl)piperidin-4-amine (PubChem CID 126464393) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(7-methoxy-4-methylquinazolin-2-yl)-N-(2-thiophen-2-ylethyl)piperidin-4-amine.
| Compound Name | 1-(7-methoxy-4-methylquinazolin-2-yl)-N-(2-thiophen-2-ylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 126464393 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-(7-methoxy-4-methylquinazolin-2-yl)-N-(2-thiophen-2-ylethyl)piperidin-4-amine |
| SMILES | COc1ccc2c(C)nc(N3CCC(NCCc4cccs4)CC3)nc2c1 |
| InChI | InChI=1S/C21H26N4OS/c1-15-19-6-5-17(26-2)14-20(19)24-21(23-15)25-11-8-16(9-12-25)22-10-7-18-4-3-13-27-18/h3-6,13-14,16,22H,7-12H2,1-2H3 |
| InChIKey | IITXPGNOQHHKES-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |