C18H26N4O — CID 95202757
(2S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 95202757) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 95202757 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1ccc2c(c1)C[C@@H](NCCCn1nc(C)nc1C)CC2 |
| InChI | InChI=1S/C18H26N4O/c1-13-20-14(2)22(21-13)10-4-9-19-17-7-5-15-6-8-18(23-3)12-16(15)11-17/h6,8,12,17,19H,4-5,7,9-11H2,1-3H3/t17-/m0/s1 |
| InChIKey | OLMBDRFPXSTCLC-KRWDZBQOSA-N |
| XLogP | 2.44 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|