C17H27N5O2 — CID 95203819
4-ethyl-3-[1-[(2R)-1-prop-2-enylpyrrolidine-2-carbonyl]piperidin-4-yl]-1H-1,2,4-triazol-5-one (PubChem CID 95203819) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-ethyl-3-[1-[(2R)-1-prop-2-enylpyrrolidine-2-carbonyl]piperidin-4-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-ethyl-3-[1-[(2R)-1-prop-2-enylpyrrolidine-2-carbonyl]piperidin-4-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 95203819 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 4-ethyl-3-[1-[(2R)-1-prop-2-enylpyrrolidine-2-carbonyl]piperidin-4-yl]-1H-1,2,4-triazol-5-one |
| SMILES | C=CCN1CCC[C@@H]1C(=O)N1CCC(c2n[nH]c(=O)n2CC)CC1 |
| InChI | InChI=1S/C17H27N5O2/c1-3-9-20-10-5-6-14(20)16(23)21-11-7-13(8-12-21)15-18-19-17(24)22(15)4-2/h3,13-14H,1,4-12H2,2H3,(H,19,24)/t14-/m1/s1 |
| InChIKey | NSZDWFONUPDNEI-CQSZACIVSA-N |
| XLogP | 0.95 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|