C16H25NO4 — CID 95203862
4-(hydroxymethyl)-1-[[5-[(2S)-oxan-2-yl]furan-2-yl]methyl]piperidin-4-ol (PubChem CID 95203862) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-[[5-[(2S)-oxan-2-yl]furan-2-yl]methyl]piperidin-4-ol.
| Compound Name | 4-(hydroxymethyl)-1-[[5-[(2S)-oxan-2-yl]furan-2-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 95203862 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-(hydroxymethyl)-1-[[5-[(2S)-oxan-2-yl]furan-2-yl]methyl]piperidin-4-ol |
| SMILES | OCC1(O)CCN(Cc2ccc([C@@H]3CCCCO3)o2)CC1 |
| InChI | InChI=1S/C16H25NO4/c18-12-16(19)6-8-17(9-7-16)11-13-4-5-15(21-13)14-3-1-2-10-20-14/h4-5,14,18-19H,1-3,6-12H2/t14-/m0/s1 |
| InChIKey | UDKCFFUQHZPLBK-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |