C21H27FN2O2 — CID 74247790
1-(4-fluorophenyl)-4-[[5-(oxan-2-yl)furan-2-yl]methyl]-1,4-diazepane (PubChem CID 74247790) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[[5-(oxan-2-yl)furan-2-yl]methyl]-1,4-diazepane.
| Compound Name | 1-(4-fluorophenyl)-4-[[5-(oxan-2-yl)furan-2-yl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 74247790 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[[5-(oxan-2-yl)furan-2-yl]methyl]-1,4-diazepane |
| SMILES | Fc1ccc(N2CCCN(Cc3ccc(C4CCCCO4)o3)CC2)cc1 |
| InChI | InChI=1S/C21H27FN2O2/c22-17-5-7-18(8-6-17)24-12-3-11-23(13-14-24)16-19-9-10-21(26-19)20-4-1-2-15-25-20/h5-10,20H,1-4,11-16H2 |
| InChIKey | RHRZVERIJCNUNI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |