C13H18N2O — CID 95204772
1-(furan-2-ylmethyl)-2-[(2R)-pentan-2-yl]imidazole (PubChem CID 95204772) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-[(2R)-pentan-2-yl]imidazole.
| Compound Name | 1-(furan-2-ylmethyl)-2-[(2R)-pentan-2-yl]imidazole |
|---|---|
| PubChem CID | 95204772 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-[(2R)-pentan-2-yl]imidazole |
| SMILES | CCC[C@@H](C)c1nccn1Cc1ccco1 |
| InChI | InChI=1S/C13H18N2O/c1-3-5-11(2)13-14-7-8-15(13)10-12-6-4-9-16-12/h4,6-9,11H,3,5,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | XZLHOJJIPAKYKJ-LLVKDONJSA-N |
| XLogP | 3.43 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |