C11H11N3OS — CID 94685888
3-[1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylpropanenitrile (PubChem CID 94685888) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 3-[1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylpropanenitrile.
| Compound Name | 3-[1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 94685888 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 3-[1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylpropanenitrile |
| SMILES | N#CCCSc1nccn1Cc1ccco1 |
| InChI | InChI=1S/C11H11N3OS/c12-4-2-8-16-11-13-5-6-14(11)9-10-3-1-7-15-10/h1,3,5-7H,2,8-9H2 |
| InChIKey | ALRCKNXSIPZNDR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|