C15H26N4O2 — CID 95205068
4-ethyl-3-[(3S)-1-hexanoylpiperidin-3-yl]-1H-1,2,4-triazol-5-one (PubChem CID 95205068) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-ethyl-3-[(3S)-1-hexanoylpiperidin-3-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-ethyl-3-[(3S)-1-hexanoylpiperidin-3-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 95205068 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-ethyl-3-[(3S)-1-hexanoylpiperidin-3-yl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCCCC(=O)N1CCC[C@H](c2n[nH]c(=O)n2CC)C1 |
| InChI | InChI=1S/C15H26N4O2/c1-3-5-6-9-13(20)18-10-7-8-12(11-18)14-16-17-15(21)19(14)4-2/h12H,3-11H2,1-2H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | XZOPSYIIEPOTRJ-LBPRGKRZSA-N |
| XLogP | 1.88 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|