C18H25FN2O2 — CID 95207678
(6R)-6-[2-(5-fluoro-2-methoxyphenyl)imidazol-1-yl]-2-methylheptan-2-ol (PubChem CID 95207678) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is (6R)-6-[2-(5-fluoro-2-methoxyphenyl)imidazol-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[2-(5-fluoro-2-methoxyphenyl)imidazol-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 95207678 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (6R)-6-[2-(5-fluoro-2-methoxyphenyl)imidazol-1-yl]-2-methylheptan-2-ol |
| SMILES | COc1ccc(F)cc1-c1nccn1[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C18H25FN2O2/c1-13(6-5-9-18(2,3)22)21-11-10-20-17(21)15-12-14(19)7-8-16(15)23-4/h7-8,10-13,22H,5-6,9H2,1-4H3/t13-/m1/s1 |
| InChIKey | SGYZSAVUNZEDKS-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |