C21H22FN3O2 — CID 95210798
2-[[(4R)-4-(2-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-methylphenol (PubChem CID 95210798) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-[[(4R)-4-(2-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-methylphenol.
| Compound Name | 2-[[(4R)-4-(2-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 95210798 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[[(4R)-4-(2-fluoro-4-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-methylphenol |
| SMILES | COc1ccc([C@@H]2c3nc[nH]c3CCN2Cc2cc(C)ccc2O)c(F)c1 |
| InChI | InChI=1S/C21H22FN3O2/c1-13-3-6-19(26)14(9-13)11-25-8-7-18-20(24-12-23-18)21(25)16-5-4-15(27-2)10-17(16)22/h3-6,9-10,12,21,26H,7-8,11H2,1-2H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | VWROQESXKUMYRM-OAQYLSRUSA-N |
| XLogP | 3.72 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|