C21H29N5 — CID 95219621
N-methyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine (PubChem CID 95219621) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is N-methyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | N-methyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95219621 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-methyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
| SMILES | CN(Cc1ccc2c(c1)CCCN2C)c1cc([C@@H]2CCCNC2)ncn1 |
| InChI | InChI=1S/C21H29N5/c1-25-10-4-6-17-11-16(7-8-20(17)25)14-26(2)21-12-19(23-15-24-21)18-5-3-9-22-13-18/h7-8,11-12,15,18,22H,3-6,9-10,13-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | ILWKIGHVCRCENF-GOSISDBHSA-N |
| XLogP | 2.96 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|