C18H22ClFN4 — CID 95197067
N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine (PubChem CID 95197067) has the molecular formula C18H22ClFN4 and a molecular weight of 348.85 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95197067 |
| Molecular Formula | C18H22ClFN4 |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-6-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
| SMILES | CCN(Cc1c(F)cccc1Cl)c1cc([C@@H]2CCCNC2)ncn1 |
| InChI | InChI=1S/C18H22ClFN4/c1-2-24(11-14-15(19)6-3-7-16(14)20)18-9-17(22-12-23-18)13-5-4-8-21-10-13/h3,6-7,9,12-13,21H,2,4-5,8,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | KFDXTLNXHGQNCB-CYBMUJFWSA-N |
| XLogP | 3.76 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |