C17H19ClFN3 — CID 69063197
(3S)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 69063197) has the molecular formula C17H19ClFN3 and a molecular weight of 319.81 g/mol. Its IUPAC name is (3S)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 69063197 |
| Molecular Formula | C17H19ClFN3 |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (3S)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | Fc1cccc(Cl)c1CN(Cc1ccccn1)[C@H]1CCNC1 |
| InChI | InChI=1S/C17H19ClFN3/c18-16-5-3-6-17(19)15(16)12-22(14-7-9-20-10-14)11-13-4-1-2-8-21-13/h1-6,8,14,20H,7,9-12H2/t14-/m0/s1 |
| InChIKey | HPIRHPOQYLTRPB-AWEZNQCLSA-N |
| XLogP | 3.24 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |