C20H29N7O — CID 95219826
N-cyclopentyl-1-[(3R)-1-(6-propan-2-ylpyridazin-3-yl)piperidin-3-yl]triazole-4-carboxamide (PubChem CID 95219826) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is N-cyclopentyl-1-[(3R)-1-(6-propan-2-ylpyridazin-3-yl)piperidin-3-yl]triazole-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[(3R)-1-(6-propan-2-ylpyridazin-3-yl)piperidin-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 95219826 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N-cyclopentyl-1-[(3R)-1-(6-propan-2-ylpyridazin-3-yl)piperidin-3-yl]triazole-4-carboxamide |
| SMILES | CC(C)c1ccc(N2CCC[C@@H](n3cc(C(=O)NC4CCCC4)nn3)C2)nn1 |
| InChI | InChI=1S/C20H29N7O/c1-14(2)17-9-10-19(24-22-17)26-11-5-8-16(12-26)27-13-18(23-25-27)20(28)21-15-6-3-4-7-15/h9-10,13-16H,3-8,11-12H2,1-2H3,(H,21,28)/t16-/m1/s1 |
| InChIKey | NPWHLDHJXHKRRO-MRXNPFEDSA-N |
| XLogP | 2.71 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |