C18H26N8O — CID 98273747
1-(4-aminocyclohexyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]triazole-4-carboxamide (PubChem CID 98273747) has the molecular formula C18H26N8O and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]triazole-4-carboxamide.
| Compound Name | 1-(4-aminocyclohexyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 98273747 |
| Molecular Formula | C18H26N8O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]triazole-4-carboxamide |
| SMILES | NC1CCC(n2cc(C(=O)N[C@H]3CCCN(c4cnccn4)C3)nn2)CC1 |
| InChI | InChI=1S/C18H26N8O/c19-13-3-5-15(6-4-13)26-12-16(23-24-26)18(27)22-14-2-1-9-25(11-14)17-10-20-7-8-21-17/h7-8,10,12-15H,1-6,9,11,19H2,(H,22,27)/t13?,14-,15?/m0/s1 |
| InChIKey | FBXXRTAJUFOXGX-SLTAFYQDSA-N |
| XLogP | 0.91 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |