C21H32N4O3 — CID 95226251
(4-morpholin-4-ylpiperidin-1-yl)-[6-[[(3R)-oxan-3-yl]methylamino]-3-pyridinyl]methanone (PubChem CID 95226251) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is (4-morpholin-4-ylpiperidin-1-yl)-[6-[[(3R)-oxan-3-yl]methylamino]-3-pyridinyl]methanone.
| Compound Name | (4-morpholin-4-ylpiperidin-1-yl)-[6-[[(3R)-oxan-3-yl]methylamino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 95226251 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (4-morpholin-4-ylpiperidin-1-yl)-[6-[[(3R)-oxan-3-yl]methylamino]-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(NC[C@H]2CCCOC2)nc1)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C21H32N4O3/c26-21(25-7-5-19(6-8-25)24-9-12-27-13-10-24)18-3-4-20(23-15-18)22-14-17-2-1-11-28-16-17/h3-4,15,17,19H,1-2,5-14,16H2,(H,22,23)/t17-/m1/s1 |
| InChIKey | XIHIXKLJJTZQBV-QGZVFWFLSA-N |
| XLogP | 1.86 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |