C13H24N2O2 — CID 95226599
N-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-methylbut-2-enamide (PubChem CID 95226599) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-methylbut-2-enamide.
| Compound Name | N-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 95226599 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-[2-[(3S)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NCCN1CCC[C@H](CO)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-11(2)8-13(17)14-5-7-15-6-3-4-12(9-15)10-16/h8,12,16H,3-7,9-10H2,1-2H3,(H,14,17)/t12-/m0/s1 |
| InChIKey | AEUIQRXMFWLZNT-LBPRGKRZSA-N |
| XLogP | 0.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|