C16H19N3O4 — CID 95229329
(3S)-3-amino-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]pyrrolidine-3-carboxylic acid (PubChem CID 95229329) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (3S)-3-amino-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-3-amino-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95229329 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (3S)-3-amino-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc2[nH]c(=O)c(CN3CC[C@@](N)(C(=O)O)C3)cc2c1 |
| InChI | InChI=1S/C16H19N3O4/c1-23-12-2-3-13-10(7-12)6-11(14(20)18-13)8-19-5-4-16(17,9-19)15(21)22/h2-3,6-7H,4-5,8-9,17H2,1H3,(H,18,20)(H,21,22)/t16-/m0/s1 |
| InChIKey | SSKUXISGAJCTRK-INIZCTEOSA-N |
| XLogP | 0.52 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |