C16H20N4O3 — CID 95220816
(3S)-3-amino-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]pyrrolidine-3-carboxylic acid (PubChem CID 95220816) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (3S)-3-amino-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-3-amino-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95220816 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (3S)-3-amino-1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(-n2ccnc2CN2CC[C@@](N)(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H20N4O3/c1-23-13-4-2-12(3-5-13)20-9-7-18-14(20)10-19-8-6-16(17,11-19)15(21)22/h2-5,7,9H,6,8,10-11,17H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | DVTVXQZUJZLWPI-INIZCTEOSA-N |
| XLogP | 0.87 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |