C16H25ClN4O — CID 95230004
N-[[(3S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]-3-methylbut-2-enamide (PubChem CID 95230004) has the molecular formula C16H25ClN4O and a molecular weight of 324.86 g/mol. Its IUPAC name is N-[[(3S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]-3-methylbut-2-enamide.
| Compound Name | N-[[(3S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 95230004 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-[[(3S)-1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NC[C@@H]1CCN(Cc2c(C)nn(C)c2Cl)C1 |
| InChI | InChI=1S/C16H25ClN4O/c1-11(2)7-15(22)18-8-13-5-6-21(9-13)10-14-12(3)19-20(4)16(14)17/h7,13H,5-6,8-10H2,1-4H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | WSQRONDAFQDINW-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|