C21H25N3O3 — CID 95235903
N'-[(1S)-1-(2-methoxyphenyl)ethyl]-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)oxamide (PubChem CID 95235903) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is N'-[(1S)-1-(2-methoxyphenyl)ethyl]-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)oxamide.
| Compound Name | N'-[(1S)-1-(2-methoxyphenyl)ethyl]-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)oxamide |
|---|---|
| PubChem CID | 95235903 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N'-[(1S)-1-(2-methoxyphenyl)ethyl]-N-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)oxamide |
| SMILES | COc1ccccc1[C@H](C)NC(=O)C(=O)Nc1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C21H25N3O3/c1-14(17-8-4-5-9-19(17)27-3)22-20(25)21(26)23-16-10-11-18-15(13-16)7-6-12-24(18)2/h4-5,8-11,13-14H,6-7,12H2,1-3H3,(H,22,25)(H,23,26)/t14-/m0/s1 |
| InChIKey | KOCYSFXZMLMHBB-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|