C29H23O2P — CID 95240121
(2S)-2-diphenylphosphoryl-4,6-diphenyl-2H-pyran (PubChem CID 95240121) has the molecular formula C29H23O2P and a molecular weight of 434.48 g/mol. Its IUPAC name is (2S)-2-diphenylphosphoryl-4,6-diphenyl-2H-pyran.
| Compound Name | (2S)-2-diphenylphosphoryl-4,6-diphenyl-2H-pyran |
|---|---|
| PubChem CID | 95240121 |
| Molecular Formula | C29H23O2P |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (2S)-2-diphenylphosphoryl-4,6-diphenyl-2H-pyran |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@H]1C=C(c2ccccc2)C=C(c2ccccc2)O1 |
| InChI | InChI=1S/C29H23O2P/c30-32(26-17-9-3-10-18-26,27-19-11-4-12-20-27)29-22-25(23-13-5-1-6-14-23)21-28(31-29)24-15-7-2-8-16-24/h1-22,29H/t29-/m0/s1 |
| InChIKey | GSUFBNUYXHVDIK-LJAQVGFWSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|