C26H24BrNO2 — CID 95242510
(Z)-1-(5-bromo-1-benzofuran-2-yl)-N-phenylmethoxy-2-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 95242510) has the molecular formula C26H24BrNO2 and a molecular weight of 462.39 g/mol. Its IUPAC name is (Z)-1-(5-bromo-1-benzofuran-2-yl)-N-phenylmethoxy-2-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | (Z)-1-(5-bromo-1-benzofuran-2-yl)-N-phenylmethoxy-2-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 95242510 |
| Molecular Formula | C26H24BrNO2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (Z)-1-(5-bromo-1-benzofuran-2-yl)-N-phenylmethoxy-2-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | Cc1cc(C)c(C/C(=N/OCc2ccccc2)c2cc3cc(Br)ccc3o2)c(C)c1 |
| InChI | InChI=1S/C26H24BrNO2/c1-17-11-18(2)23(19(3)12-17)15-24(28-29-16-20-7-5-4-6-8-20)26-14-21-13-22(27)9-10-25(21)30-26/h4-14H,15-16H2,1-3H3/b28-24- |
| InChIKey | JNWSRVTVPHJPNE-COOPMVRXSA-N |
| XLogP | 7.28 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|