C17H19N3O2S2 — CID 95261909
(3S,7aR)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 95261909) has the molecular formula C17H19N3O2S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (3S,7aR)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 95261909 |
| Molecular Formula | C17H19N3O2S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (3S,7aR)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](C(=O)Nc1sc3c(c1C#N)CCCC3)CS2 |
| InChI | InChI=1S/C17H19N3O2S2/c1-17-7-6-14(21)20(17)12(9-23-17)15(22)19-16-11(8-18)10-4-2-3-5-13(10)24-16/h12H,2-7,9H2,1H3,(H,19,22)/t12-,17-/m1/s1 |
| InChIKey | LQABPRWILCYERQ-SJKOYZFVSA-N |
| XLogP | 2.89 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |