C18H22FN3O — CID 95264423
3-[3-(3-fluorophenyl)propyl]-1-methyl-1-[(1S)-1-pyridin-3-ylethyl]urea (PubChem CID 95264423) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-[3-(3-fluorophenyl)propyl]-1-methyl-1-[(1S)-1-pyridin-3-ylethyl]urea.
| Compound Name | 3-[3-(3-fluorophenyl)propyl]-1-methyl-1-[(1S)-1-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 95264423 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 3-[3-(3-fluorophenyl)propyl]-1-methyl-1-[(1S)-1-pyridin-3-ylethyl]urea |
| SMILES | C[C@@H](c1cccnc1)N(C)C(=O)NCCCc1cccc(F)c1 |
| InChI | InChI=1S/C18H22FN3O/c1-14(16-8-5-10-20-13-16)22(2)18(23)21-11-4-7-15-6-3-9-17(19)12-15/h3,5-6,8-10,12-14H,4,7,11H2,1-2H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | HVRDLSQRPZNVIK-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|