C18H21F2N3O — CID 95628763
3-[2-(2,4-difluorophenyl)ethyl]-1-ethyl-1-[(1R)-1-pyridin-3-ylethyl]urea (PubChem CID 95628763) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenyl)ethyl]-1-ethyl-1-[(1R)-1-pyridin-3-ylethyl]urea.
| Compound Name | 3-[2-(2,4-difluorophenyl)ethyl]-1-ethyl-1-[(1R)-1-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 95628763 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[2-(2,4-difluorophenyl)ethyl]-1-ethyl-1-[(1R)-1-pyridin-3-ylethyl]urea |
| SMILES | CCN(C(=O)NCCc1ccc(F)cc1F)[C@H](C)c1cccnc1 |
| InChI | InChI=1S/C18H21F2N3O/c1-3-23(13(2)15-5-4-9-21-12-15)18(24)22-10-8-14-6-7-16(19)11-17(14)20/h4-7,9,11-13H,3,8,10H2,1-2H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | LQXHMFFERKVRKC-CYBMUJFWSA-N |
| XLogP | 3.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |