C13H17F3N2O3 — CID 95266924
1-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-(2-methoxyethyl)urea (PubChem CID 95266924) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 95266924 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NC[C@H](O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O3/c1-21-7-6-17-12(20)18-8-11(19)9-4-2-3-5-10(9)13(14,15)16/h2-5,11,19H,6-8H2,1H3,(H2,17,18,20)/t11-/m0/s1 |
| InChIKey | LWDXFSSNIOAPGV-NSHDSACASA-N |
| XLogP | 1.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|