C17H22N2O2 — CID 95267093
1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 95267093) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 95267093 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | O=C(NC[C@H]1CC=CCC1)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C17H22N2O2/c20-15-10-13-8-4-5-9-14(13)16(15)19-17(21)18-11-12-6-2-1-3-7-12/h1-2,4-5,8-9,12,15-16,20H,3,6-7,10-11H2,(H2,18,19,21)/t12-,15+,16-/m0/s1 |
| InChIKey | CSYRAJSQBVDRKM-MAZHCROVSA-N |
| XLogP | 2.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|