C16H19N3O4S — CID 95271806
(4S)-N-(cyclopropylmethyl)-3-(3-methyl-4-nitrobenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 95271806) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is (4S)-N-(cyclopropylmethyl)-3-(3-methyl-4-nitrobenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-(cyclopropylmethyl)-3-(3-methyl-4-nitrobenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95271806 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (4S)-N-(cyclopropylmethyl)-3-(3-methyl-4-nitrobenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N2CSC[C@@H]2C(=O)NCC2CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O4S/c1-10-6-12(4-5-13(10)19(22)23)16(21)18-9-24-8-14(18)15(20)17-7-11-2-3-11/h4-6,11,14H,2-3,7-9H2,1H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | LZIOCGVINOJKKW-CQSZACIVSA-N |
| XLogP | 1.94 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|