C18H27ClN4O4 — CID 120654300
N-[(2R)-2-(ethylamino)propyl]-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 120654300) has the molecular formula C18H27ClN4O4 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120654300 |
| Molecular Formula | C18H27ClN4O4 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)C1CCCN1C(=O)c1ccc([N+](=O)[O-])c(C)c1.Cl |
| InChI | InChI=1S/C18H26N4O4.ClH/c1-4-19-13(3)11-20-17(23)16-6-5-9-21(16)18(24)14-7-8-15(22(25)26)12(2)10-14;/h7-8,10,13,16,19H,4-6,9,11H2,1-3H3,(H,20,23);1H/t13-,16?;/m1./s1 |
| InChIKey | FVHNQCOIKPHJPE-FMVIYNIGSA-N |
| XLogP | 2.04 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|