C15H19N3O2 — CID 95276384
(2S,3S)-N-(1,3-benzodioxol-4-ylmethyl)-3-pyrazol-1-ylbutan-2-amine (PubChem CID 95276384) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (2S,3S)-N-(1,3-benzodioxol-4-ylmethyl)-3-pyrazol-1-ylbutan-2-amine.
| Compound Name | (2S,3S)-N-(1,3-benzodioxol-4-ylmethyl)-3-pyrazol-1-ylbutan-2-amine |
|---|---|
| PubChem CID | 95276384 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2S,3S)-N-(1,3-benzodioxol-4-ylmethyl)-3-pyrazol-1-ylbutan-2-amine |
| SMILES | C[C@H](NCc1cccc2c1OCO2)[C@H](C)n1cccn1 |
| InChI | InChI=1S/C15H19N3O2/c1-11(12(2)18-8-4-7-17-18)16-9-13-5-3-6-14-15(13)20-10-19-14/h3-8,11-12,16H,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | QCSCYUHGBLKIAD-RYUDHWBXSA-N |
| XLogP | 2.35 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |