C19H21N5O — CID 95277241
[4-(pyrazol-1-ylmethyl)phenyl]-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone (PubChem CID 95277241) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is [4-(pyrazol-1-ylmethyl)phenyl]-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone.
| Compound Name | [4-(pyrazol-1-ylmethyl)phenyl]-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95277241 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [4-(pyrazol-1-ylmethyl)phenyl]-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cn2cccn2)cc1)N1CCC[C@@H](n2cccn2)C1 |
| InChI | InChI=1S/C19H21N5O/c25-19(22-11-1-4-18(15-22)24-13-3-10-21-24)17-7-5-16(6-8-17)14-23-12-2-9-20-23/h2-3,5-10,12-13,18H,1,4,11,14-15H2/t18-/m1/s1 |
| InChIKey | LNAJFHHNGRPCKC-GOSISDBHSA-N |
| XLogP | 2.61 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |