C16H17N3O3 — CID 95158283
1,3-benzodioxol-5-yl-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone (PubChem CID 95158283) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95158283 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCC[C@@H](n2cccn2)C1 |
| InChI | InChI=1S/C16H17N3O3/c20-16(12-4-5-14-15(9-12)22-11-21-14)18-7-1-3-13(10-18)19-8-2-6-17-19/h2,4-6,8-9,13H,1,3,7,10-11H2/t13-/m1/s1 |
| InChIKey | MARAYBOVLUCSIL-CYBMUJFWSA-N |
| XLogP | 2.09 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |