C13H14BrN3OS — CID 95158101
(5-bromothiophen-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone (PubChem CID 95158101) has the molecular formula C13H14BrN3OS and a molecular weight of 340.25 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone.
| Compound Name | (5-bromothiophen-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95158101 |
| Molecular Formula | C13H14BrN3OS |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | (5-bromothiophen-3-yl)-[(3R)-3-pyrazol-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1csc(Br)c1)N1CCC[C@@H](n2cccn2)C1 |
| InChI | InChI=1S/C13H14BrN3OS/c14-12-7-10(9-19-12)13(18)16-5-1-3-11(8-16)17-6-2-4-15-17/h2,4,6-7,9,11H,1,3,5,8H2/t11-/m1/s1 |
| InChIKey | VICVDOACVWABJY-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |