C18H19F2N3O2 — CID 95278200
2-(2-acetamido-4,5-difluoroanilino)-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 95278200) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-(2-acetamido-4,5-difluoroanilino)-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-(2-acetamido-4,5-difluoroanilino)-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 95278200 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-(2-acetamido-4,5-difluoroanilino)-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(F)cc1NCC(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-11(13-6-4-3-5-7-13)22-18(25)10-21-16-8-14(19)15(20)9-17(16)23-12(2)24/h3-9,11,21H,10H2,1-2H3,(H,22,25)(H,23,24)/t11-/m1/s1 |
| InChIKey | YZGWEGAIBTXJBC-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |