C17H16FN3O — CID 99637714
2-(4-cyano-2-fluoroanilino)-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 99637714) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-(4-cyano-2-fluoroanilino)-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-(4-cyano-2-fluoroanilino)-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 99637714 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(4-cyano-2-fluoroanilino)-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CNc1ccc(C#N)cc1F)c1ccccc1 |
| InChI | InChI=1S/C17H16FN3O/c1-12(14-5-3-2-4-6-14)21-17(22)11-20-16-8-7-13(10-19)9-15(16)18/h2-9,12,20H,11H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | KLXJPXMOKHSEHA-GFCCVEGCSA-N |
| XLogP | 2.99 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |